![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| baby smiles.jpg | 2005-01-14 17:55 | 15K | |
| brush teeth.jpg | 2005-01-13 23:56 | 15K | |
| catch a taxi.jpg | 2005-01-14 00:00 | 16K | |
| close the window.jpg | 2005-01-13 23:58 | 12K | |
| cry at the movie the..> | 2005-01-13 23:59 | 10K | |
| eat pizza.jpg | 2005-01-14 17:56 | 15K | |
| food is left over.jpg | 2005-01-14 17:57 | 59K | |
| get an a.jpg | 2005-01-14 17:57 | 4.7K | |
| hold a baby.jpg | 2005-01-14 00:02 | 9.9K | |
| hold hands.jpg | 2005-01-14 18:00 | 16K | |
| know korean.jpg | 2005-01-14 18:08 | 15K | |
| let go of a hand.jpg | 2005-01-14 00:03 | 7.1K | |
| living in apartment.jpg | 2005-01-14 18:09 | 19K | |
| make a sandwich.jpg | 2005-01-14 18:14 | 27K | |
| open the door.jpg | 2005-01-14 00:02 | 12K | |
| play with a friend.jpg | 2005-01-14 00:03 | 17K | |
| put a book in the ba..> | 2005-01-14 00:04 | 15K | |
| put a pen on the tab..> | 2005-01-14 18:15 | 17K | |
| put on pajamas.jpg | 2005-01-14 18:15 | 11K | |
| sit on a chair.jpg | 2005-01-13 23:58 | 15K | |
| wash a car.jpg | 2005-01-14 18:16 | 23K | |
| wash hands.jpg | 2005-01-13 23:59 | 16K | |
| withdraw money at th..> | 2005-01-14 00:00 | 13K | |
