![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| withdraw money at th..> | 2005-04-03 17:12 | 32K | |
| wash hands.mp3 | 2005-04-03 17:12 | 28K | |
| wash a car.mp3 | 2005-04-03 17:12 | 25K | |
| sit on a chair.mp3 | 2005-04-03 17:12 | 26K | |
| read a newspaper.mp3 | 2005-04-03 17:12 | 30K | |
| put on pajamas.mp3 | 2005-04-03 17:12 | 25K | |
| put a pen on the tab..> | 2005-04-03 17:12 | 33K | |
| put a book in the ba..> | 2005-04-03 17:12 | 33K | |
| play with a friend.mp3 | 2005-04-03 17:12 | 29K | |
| open the door.mp3 | 2005-04-03 17:12 | 24K | |
| make a sandwich.mp3 | 2005-04-03 17:12 | 33K | |
| look for a friend.mp3 | 2005-04-03 17:12 | 29K | |
| living in apartment.mp3 | 2005-04-03 17:12 | 27K | |
| let go of a hand.mp3 | 2005-04-03 17:12 | 21K | |
| know korean.mp3 | 2005-04-03 17:12 | 28K | |
| hold hands.mp3 | 2005-04-03 17:12 | 26K | |
| hold a baby.mp3 | 2005-04-03 17:12 | 29K | |
| get an a.mp3 | 2005-04-03 17:12 | 24K | |
| food is left over.mp3 | 2005-04-03 17:12 | 25K | |
| eat pizza.mp3 | 2005-04-03 17:12 | 25K | |
| cry at the movie the..> | 2005-04-03 17:12 | 29K | |
| close the window.mp3 | 2005-04-03 17:12 | 26K | |
| catch a taxi.mp3 | 2005-04-03 17:12 | 27K | |
| brush teeth.mp3 | 2005-04-03 17:12 | 29K | |
| baby smiles.mp3 | 2005-04-03 17:12 | 28K | |